C15H17ClN2OS — CID 117232231
5-chloro-4-phenylmethoxy-1-(thiolan-2-ylmethyl)pyrazole (PubChem CID 117232231) has the molecular formula C15H17ClN2OS and a molecular weight of 308.83 g/mol. Its IUPAC name is 5-chloro-4-phenylmethoxy-1-(thiolan-2-ylmethyl)pyrazole.
| Compound Name | 5-chloro-4-phenylmethoxy-1-(thiolan-2-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 117232231 |
| Molecular Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 5-chloro-4-phenylmethoxy-1-(thiolan-2-ylmethyl)pyrazole |
| SMILES | Clc1c(OCc2ccccc2)cnn1CC1CCCS1 |
| InChI | InChI=1S/C15H17ClN2OS/c16-15-14(19-11-12-5-2-1-3-6-12)9-17-18(15)10-13-7-4-8-20-13/h1-3,5-6,9,13H,4,7-8,10-11H2 |
| InChIKey | GKWWNLPFGJNGCU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |