C8H11BrN2O3S — CID 117232265
5-bromo-1-[(1,1-dioxothiolan-2-yl)methyl]pyrazol-4-ol (PubChem CID 117232265) has the molecular formula C8H11BrN2O3S and a molecular weight of 295.16 g/mol. Its IUPAC name is 5-bromo-1-[(1,1-dioxothiolan-2-yl)methyl]pyrazol-4-ol.
| Compound Name | 5-bromo-1-[(1,1-dioxothiolan-2-yl)methyl]pyrazol-4-ol |
|---|---|
| PubChem CID | 117232265 |
| Molecular Formula | C8H11BrN2O3S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 5-bromo-1-[(1,1-dioxothiolan-2-yl)methyl]pyrazol-4-ol |
| SMILES | O=S1(=O)CCCC1Cn1ncc(O)c1Br |
| InChI | InChI=1S/C8H11BrN2O3S/c9-8-7(12)4-10-11(8)5-6-2-1-3-15(6,13)14/h4,6,12H,1-3,5H2 |
| InChIKey | OGDLJOTTYVOGFE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |