C19H25FN2O — CID 11723305
8-(dipropylamino)-4-fluoro-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde (PubChem CID 11723305) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 8-(dipropylamino)-4-fluoro-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde.
| Compound Name | 8-(dipropylamino)-4-fluoro-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 11723305 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 8-(dipropylamino)-4-fluoro-6,7,8,9-tetrahydro-3H-benzo[e]indole-1-carbaldehyde |
| SMILES | CCCN(CCC)C1CCc2cc(F)c3[nH]cc(C=O)c3c2C1 |
| InChI | InChI=1S/C19H25FN2O/c1-3-7-22(8-4-2)15-6-5-13-9-17(20)19-18(16(13)10-15)14(12-23)11-21-19/h9,11-12,15,21H,3-8,10H2,1-2H3 |
| InChIKey | ICOOOYKBBQSJND-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|