About N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine
N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine (PubChem CID 11723323) has the molecular formula C19H28N2S
and a molecular weight of 316.51 g/mol. Its IUPAC name is N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine |
| PubChem CID | 11723323 |
| Molecular Formula | C19H28N2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNC1(c2cc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C19H28N2S/c1-20-13-7-8-14-21-19(11-5-2-6-12-19)18-15-16-9-3-4-10-17(16)22-18/h3-4,9-10,15,20-21H,2,5-8,11-14H2,1H3 |
| InChIKey | UWZJSCZAWUPCMJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine?
The IUPAC name of N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine (CID 11723323) is N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine.
What is the SMILES notation for N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine?
The canonical SMILES for N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine is CNCCCCNC1(c2cc3ccccc3s2)CCCCC1.
What is the InChIKey of N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine?
The InChIKey is UWZJSCZAWUPCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2S/c1-20-13-7-8-14-21-19(11-5-2-6-12-19)18-15-16-9-3-4-10-17(16)22-18/h3-4,9-10,15,20-21H,2,5-8,11-14H2,1H3.
What are the key properties of N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine?
N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine has a molecular weight of 316.51 g/mol, XLogP of 4.65, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(1-benzothiophen-2-yl)cyclohexyl]-N-methylbutane-1,4-diamine is sourced from PubChem (CID 11723323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).