About 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide
3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide (PubChem CID 117233293) has the molecular formula C7H9NO4S
and a molecular weight of 203.22 g/mol. Its IUPAC name is 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide |
| PubChem CID | 117233293 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Oc2cnoc2)C1 |
| InChI | InChI=1S/C7H9NO4S/c9-13(10)2-1-6(5-13)12-7-3-8-11-4-7/h3-4,6H,1-2,5H2 |
| InChIKey | NJSDGGBIUMWPGS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide?
The IUPAC name of 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide (CID 117233293) is 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide.
What is the SMILES notation for 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide?
The canonical SMILES for 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide is O=S1(=O)CCC(Oc2cnoc2)C1.
What is the InChIKey of 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide?
The InChIKey is NJSDGGBIUMWPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4S/c9-13(10)2-1-6(5-13)12-7-3-8-11-4-7/h3-4,6H,1-2,5H2.
What are the key properties of 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide?
3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide has a molecular weight of 203.22 g/mol, XLogP of 0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-4-yloxy)thiolane 1,1-dioxide is sourced from PubChem (CID 117233293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).