About 4-(thian-3-yloxy)-1,2-oxazole
4-(thian-3-yloxy)-1,2-oxazole (PubChem CID 117233309) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-(thian-3-yloxy)-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(thian-3-yloxy)-1,2-oxazole |
| PubChem CID | 117233309 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 4-(thian-3-yloxy)-1,2-oxazole |
| SMILES | c1nocc1OC1CCCSC1 |
| InChI | InChI=1S/C8H11NO2S/c1-2-7(6-12-3-1)11-8-4-9-10-5-8/h4-5,7H,1-3,6H2 |
| InChIKey | KPJQMPXAKHPYLK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(thian-3-yloxy)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thian-3-yloxy)-1,2-oxazole?
The IUPAC name of 4-(thian-3-yloxy)-1,2-oxazole (CID 117233309) is 4-(thian-3-yloxy)-1,2-oxazole.
What is the SMILES notation for 4-(thian-3-yloxy)-1,2-oxazole?
The canonical SMILES for 4-(thian-3-yloxy)-1,2-oxazole is c1nocc1OC1CCCSC1.
What is the InChIKey of 4-(thian-3-yloxy)-1,2-oxazole?
The InChIKey is KPJQMPXAKHPYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-2-7(6-12-3-1)11-8-4-9-10-5-8/h4-5,7H,1-3,6H2.
What are the key properties of 4-(thian-3-yloxy)-1,2-oxazole?
4-(thian-3-yloxy)-1,2-oxazole has a molecular weight of 185.25 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thian-3-yloxy)-1,2-oxazole is sourced from PubChem (CID 117233309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).