C10H16N2O3S — CID 117233469
3-[(1-methylpyrazol-4-yl)oxymethyl]thiane 1,1-dioxide (PubChem CID 117233469) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-4-yl)oxymethyl]thiane 1,1-dioxide.
| Compound Name | 3-[(1-methylpyrazol-4-yl)oxymethyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117233469 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-[(1-methylpyrazol-4-yl)oxymethyl]thiane 1,1-dioxide |
| SMILES | Cn1cc(OCC2CCCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C10H16N2O3S/c1-12-6-10(5-11-12)15-7-9-3-2-4-16(13,14)8-9/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | WTVWZZLIDAUDGB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |