About 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide
4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide (PubChem CID 117233686) has the molecular formula C8H11NO3S2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide |
| PubChem CID | 117233686 |
| Molecular Formula | C8H11NO3S2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)C=C(OC2CCCCS2)C=N1 |
| InChI | InChI=1S/C8H11NO3S2/c10-14(11)6-7(5-9-14)12-8-3-1-2-4-13-8/h5-6,8H,1-4H2 |
| InChIKey | RSXANVUSZQIBBA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide?
The IUPAC name of 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide (CID 117233686) is 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide.
What is the SMILES notation for 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide?
The canonical SMILES for 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide is O=S1(=O)C=C(OC2CCCCS2)C=N1.
What is the InChIKey of 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide?
The InChIKey is RSXANVUSZQIBBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S2/c10-14(11)6-7(5-9-14)12-8-3-1-2-4-13-8/h5-6,8H,1-4H2.
What are the key properties of 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide?
4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide has a molecular weight of 233.31 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thian-2-yloxy)-1,2-thiazole 1,1-dioxide is sourced from PubChem (CID 117233686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).