C14H18F3N3O — CID 117235427
1-(pyrrolidin-3-ylmethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 117235427) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 1-(pyrrolidin-3-ylmethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(pyrrolidin-3-ylmethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 117235427 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(pyrrolidin-3-ylmethyl)-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)NCC1CCNC1 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)12-3-1-2-10(6-12)8-19-13(21)20-9-11-4-5-18-7-11/h1-3,6,11,18H,4-5,7-9H2,(H2,19,20,21) |
| InChIKey | YGKZBLXGIFVQJJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |