C10H14BrN3O — CID 117235648
1-(2-aminoethyl)-3-[(4-bromophenyl)methyl]urea (PubChem CID 117235648) has the molecular formula C10H14BrN3O and a molecular weight of 272.15 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-[(4-bromophenyl)methyl]urea.
| Compound Name | 1-(2-aminoethyl)-3-[(4-bromophenyl)methyl]urea |
|---|---|
| PubChem CID | 117235648 |
| Molecular Formula | C10H14BrN3O |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-(2-aminoethyl)-3-[(4-bromophenyl)methyl]urea |
| SMILES | NCCNC(=O)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C10H14BrN3O/c11-9-3-1-8(2-4-9)7-14-10(15)13-6-5-12/h1-4H,5-7,12H2,(H2,13,14,15) |
| InChIKey | GIBKNOYPCVHFTR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |