C12H16BrNO3 — CID 117236636
tert-butyl N-[2-bromo-5-(hydroxymethyl)phenyl]carbamate (PubChem CID 117236636) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is tert-butyl N-[2-bromo-5-(hydroxymethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-bromo-5-(hydroxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117236636 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | tert-butyl N-[2-bromo-5-(hydroxymethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CO)ccc1Br |
| InChI | InChI=1S/C12H16BrNO3/c1-12(2,3)17-11(16)14-10-6-8(7-15)4-5-9(10)13/h4-6,15H,7H2,1-3H3,(H,14,16) |
| InChIKey | RHNVDHWGBFGKMA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |