C7H15NO2 — CID 117236694
4-(cyclopropylamino)butane-1,3-diol (PubChem CID 117236694) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-(cyclopropylamino)butane-1,3-diol.
| Compound Name | 4-(cyclopropylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 117236694 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 4-(cyclopropylamino)butane-1,3-diol |
| SMILES | OCCC(O)CNC1CC1 |
| InChI | InChI=1S/C7H15NO2/c9-4-3-7(10)5-8-6-1-2-6/h6-10H,1-5H2 |
| InChIKey | NNIWOFNGOJNCTE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |