C20H34O3 — CID 11723673
(2E,10E,14E)-3,11,15-trimethyl-7-methylidenehexadeca-2,10,14-triene-1,6,16-triol (PubChem CID 11723673) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (2E,10E,14E)-3,11,15-trimethyl-7-methylidenehexadeca-2,10,14-triene-1,6,16-triol.
| Compound Name | (2E,10E,14E)-3,11,15-trimethyl-7-methylidenehexadeca-2,10,14-triene-1,6,16-triol |
|---|---|
| PubChem CID | 11723673 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (2E,10E,14E)-3,11,15-trimethyl-7-methylidenehexadeca-2,10,14-triene-1,6,16-triol |
| SMILES | C=C(CC/C=C(\C)CC/C=C(\C)CO)C(O)CC/C(C)=C/CO |
| InChI | InChI=1S/C20H34O3/c1-16(7-5-9-18(3)15-22)8-6-10-19(4)20(23)12-11-17(2)13-14-21/h8-9,13,20-23H,4-7,10-12,14-15H2,1-3H3/b16-8+,17-13+,18-9+ |
| InChIKey | QBSXZZOSIOENJV-RVIGLEPGSA-N |
| XLogP | 4.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|