C12H17FN2O — CID 117237369
2-(3-fluorophenoxy)-1-pyrrolidin-3-ylethanamine (PubChem CID 117237369) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-1-pyrrolidin-3-ylethanamine.
| Compound Name | 2-(3-fluorophenoxy)-1-pyrrolidin-3-ylethanamine |
|---|---|
| PubChem CID | 117237369 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(3-fluorophenoxy)-1-pyrrolidin-3-ylethanamine |
| SMILES | NC(COc1cccc(F)c1)C1CCNC1 |
| InChI | InChI=1S/C12H17FN2O/c13-10-2-1-3-11(6-10)16-8-12(14)9-4-5-15-7-9/h1-3,6,9,12,15H,4-5,7-8,14H2 |
| InChIKey | VOKWZBDDEPFSRW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |