C15H23ClN2O — CID 117237900
3-(3-chlorophenoxy)-2-(1-ethylpyrrolidin-3-yl)propan-1-amine (PubChem CID 117237900) has the molecular formula C15H23ClN2O and a molecular weight of 282.81 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-2-(1-ethylpyrrolidin-3-yl)propan-1-amine.
| Compound Name | 3-(3-chlorophenoxy)-2-(1-ethylpyrrolidin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 117237900 |
| Molecular Formula | C15H23ClN2O |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-(3-chlorophenoxy)-2-(1-ethylpyrrolidin-3-yl)propan-1-amine |
| SMILES | CCN1CCC(C(CN)COc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H23ClN2O/c1-2-18-7-6-12(10-18)13(9-17)11-19-15-5-3-4-14(16)8-15/h3-5,8,12-13H,2,6-7,9-11,17H2,1H3 |
| InChIKey | PTVZITQACFZWEZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |