C17H25NO4 — CID 117238314
3-(2-methoxyphenoxy)-2-(1-propan-2-ylpyrrolidin-3-yl)propanoic acid (PubChem CID 117238314) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-(2-methoxyphenoxy)-2-(1-propan-2-ylpyrrolidin-3-yl)propanoic acid.
| Compound Name | 3-(2-methoxyphenoxy)-2-(1-propan-2-ylpyrrolidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 117238314 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-(2-methoxyphenoxy)-2-(1-propan-2-ylpyrrolidin-3-yl)propanoic acid |
| SMILES | COc1ccccc1OCC(C(=O)O)C1CCN(C(C)C)C1 |
| InChI | InChI=1S/C17H25NO4/c1-12(2)18-9-8-13(10-18)14(17(19)20)11-22-16-7-5-4-6-15(16)21-3/h4-7,12-14H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | VCXSKXYWRINYRN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |