C17H27NO5 — CID 11723842
methyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-pentan-3-yloxycyclohexene-1-carboxylate (PubChem CID 11723842) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-pentan-3-yloxycyclohexene-1-carboxylate.
| Compound Name | methyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-pentan-3-yloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11723842 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | methyl (3R,4R,5R)-4-acetamido-5-(2-oxoethyl)-3-pentan-3-yloxycyclohexene-1-carboxylate |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)OC)C[C@H](CC=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H27NO5/c1-5-14(6-2)23-15-10-13(17(21)22-4)9-12(7-8-19)16(15)18-11(3)20/h8,10,12,14-16H,5-7,9H2,1-4H3,(H,18,20)/t12-,15+,16+/m0/s1 |
| InChIKey | NMCLUKIJHHVRKS-APHBMKBZSA-N |
| XLogP | 1.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|