About 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid
7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid (PubChem CID 11723888) has the molecular formula C17H14N2O5
and a molecular weight of 326.31 g/mol. Its IUPAC name is 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid |
| PubChem CID | 11723888 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid |
| SMILES | Nc1cc2nc(C(=O)O)cc(Cc3ccc(O)c(O)c3)c2cc1O |
| InChI | InChI=1S/C17H14N2O5/c18-11-7-12-10(6-15(11)21)9(5-13(19-12)17(23)24)3-8-1-2-14(20)16(22)4-8/h1-2,4-7,20-22H,3,18H2,(H,23,24) |
| InChIKey | IUUQQZASOWMOPT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid?
The IUPAC name of 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid (CID 11723888) is 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid.
What is the SMILES notation for 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid?
The canonical SMILES for 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid is Nc1cc2nc(C(=O)O)cc(Cc3ccc(O)c(O)c3)c2cc1O.
What is the InChIKey of 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid?
The InChIKey is IUUQQZASOWMOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O5/c18-11-7-12-10(6-15(11)21)9(5-13(19-12)17(23)24)3-8-1-2-14(20)16(22)4-8/h1-2,4-7,20-22H,3,18H2,(H,23,24).
What are the key properties of 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid?
7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid has a molecular weight of 326.31 g/mol, XLogP of 2.22, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-[(3,4-dihydroxyphenyl)methyl]-6-hydroxyquinoline-2-carboxylic acid is sourced from PubChem (CID 11723888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).