C12H17NO3 — CID 117238948
1-(oxan-4-yl)-2-pyridin-3-yloxyethanol (PubChem CID 117238948) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-(oxan-4-yl)-2-pyridin-3-yloxyethanol.
| Compound Name | 1-(oxan-4-yl)-2-pyridin-3-yloxyethanol |
|---|---|
| PubChem CID | 117238948 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(oxan-4-yl)-2-pyridin-3-yloxyethanol |
| SMILES | OC(COc1cccnc1)C1CCOCC1 |
| InChI | InChI=1S/C12H17NO3/c14-12(10-3-6-15-7-4-10)9-16-11-2-1-5-13-8-11/h1-2,5,8,10,12,14H,3-4,6-7,9H2 |
| InChIKey | QSVCXTRFHQTJBK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |