About 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol
2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol (PubChem CID 117239164) has the molecular formula C9H18O5S2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol |
| PubChem CID | 117239164 |
| Molecular Formula | C9H18O5S2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol |
| SMILES | CS(=O)(=O)CC(CO)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18O5S2/c1-15(11,12)7-9(6-10)8-2-4-16(13,14)5-3-8/h8-10H,2-7H2,1H3 |
| InChIKey | HZUWWTNHFSIQCJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol?
The IUPAC name of 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol (CID 117239164) is 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol.
What is the SMILES notation for 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol?
The canonical SMILES for 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol is CS(=O)(=O)CC(CO)C1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol?
The InChIKey is HZUWWTNHFSIQCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5S2/c1-15(11,12)7-9(6-10)8-2-4-16(13,14)5-3-8/h8-10H,2-7H2,1H3.
What are the key properties of 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol?
2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol has a molecular weight of 270.37 g/mol, XLogP of -0.54, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothian-4-yl)-3-methylsulfonylpropan-1-ol is sourced from PubChem (CID 117239164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).