About 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine
8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine (PubChem CID 11724078) has the molecular formula C17H17ClN4O
and a molecular weight of 328.80 g/mol. Its IUPAC name is 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine |
| PubChem CID | 11724078 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine |
| SMILES | CN1CCN(C2=Nc3cccnc3Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C17H17ClN4O/c1-21-7-9-22(10-8-21)16-13-11-12(18)4-5-15(13)23-17-14(20-16)3-2-6-19-17/h2-6,11H,7-10H2,1H3 |
| InChIKey | CMKNDZODKSREHV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine?
The IUPAC name of 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine (CID 11724078) is 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine.
What is the SMILES notation for 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine?
The canonical SMILES for 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine is CN1CCN(C2=Nc3cccnc3Oc3ccc(Cl)cc32)CC1.
What is the InChIKey of 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine?
The InChIKey is CMKNDZODKSREHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN4O/c1-21-7-9-22(10-8-21)16-13-11-12(18)4-5-15(13)23-17-14(20-16)3-2-6-19-17/h2-6,11H,7-10H2,1H3.
What are the key properties of 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine?
8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine has a molecular weight of 328.80 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzoxazepine is sourced from PubChem (CID 11724078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).