C19H15N5O — CID 11724105
4-methyl-N,7-diphenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide (PubChem CID 11724105) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-methyl-N,7-diphenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide.
| Compound Name | 4-methyl-N,7-diphenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide |
|---|---|
| PubChem CID | 11724105 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-methyl-N,7-diphenylpyrazolo[5,1-c][1,2,4]triazine-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)nnc2cc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C19H15N5O/c1-13-18(19(25)20-15-10-6-3-7-11-15)22-21-17-12-16(23-24(13)17)14-8-4-2-5-9-14/h2-12H,1H3,(H,20,25) |
| InChIKey | PNQSEXUMYSYGLP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |