C21H30O3 — CID 11724204
(2R,3R,5R,9R,10R)-3-hydroxy-2,6,6,9-tetramethylpentacyclo[11.3.1.01,13.02,10.05,9]heptadecane-7,14-dione (PubChem CID 11724204) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R,3R,5R,9R,10R)-3-hydroxy-2,6,6,9-tetramethylpentacyclo[11.3.1.01,13.02,10.05,9]heptadecane-7,14-dione.
| Compound Name | (2R,3R,5R,9R,10R)-3-hydroxy-2,6,6,9-tetramethylpentacyclo[11.3.1.01,13.02,10.05,9]heptadecane-7,14-dione |
|---|---|
| PubChem CID | 11724204 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2R,3R,5R,9R,10R)-3-hydroxy-2,6,6,9-tetramethylpentacyclo[11.3.1.01,13.02,10.05,9]heptadecane-7,14-dione |
| SMILES | CC1(C)C(=O)C[C@]2(C)[C@H]3CCC45CC4(CCC5=O)[C@]3(C)[C@H](O)C[C@@H]12 |
| InChI | InChI=1S/C21H30O3/c1-17(2)13-9-15(23)19(4)12(18(13,3)10-16(17)24)5-7-20-11-21(19,20)8-6-14(20)22/h12-13,15,23H,5-11H2,1-4H3/t12-,13+,15-,18-,19+,20?,21?/m1/s1 |
| InChIKey | ZJENTGXTPDIWMF-DQRMPUAMSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |