C15H21FO3 — CID 117242234
methyl 2-[(4-fluorophenoxy)methyl]-4,4-dimethylpentanoate (PubChem CID 117242234) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenoxy)methyl]-4,4-dimethylpentanoate.
| Compound Name | methyl 2-[(4-fluorophenoxy)methyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 117242234 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl 2-[(4-fluorophenoxy)methyl]-4,4-dimethylpentanoate |
| SMILES | COC(=O)C(COc1ccc(F)cc1)CC(C)(C)C |
| InChI | InChI=1S/C15H21FO3/c1-15(2,3)9-11(14(17)18-4)10-19-13-7-5-12(16)6-8-13/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | VSDHBOJKPBVUEF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |