C11H15FN2 — CID 117242573
N'-cyclopropyl-1-(3-fluorophenyl)ethane-1,2-diamine (PubChem CID 117242573) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is N'-cyclopropyl-1-(3-fluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-1-(3-fluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 117242573 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N'-cyclopropyl-1-(3-fluorophenyl)ethane-1,2-diamine |
| SMILES | NC(CNC1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C11H15FN2/c12-9-3-1-2-8(6-9)11(13)7-14-10-4-5-10/h1-3,6,10-11,14H,4-5,7,13H2 |
| InChIKey | JIPHSIZAQBMWRR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |