C15H13ClO4 — CID 117243432
3-(3-chlorophenoxy)-2-(3-hydroxyphenyl)propanoic acid (PubChem CID 117243432) has the molecular formula C15H13ClO4 and a molecular weight of 292.72 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-2-(3-hydroxyphenyl)propanoic acid.
| Compound Name | 3-(3-chlorophenoxy)-2-(3-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117243432 |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(3-chlorophenoxy)-2-(3-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(COc1cccc(Cl)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H13ClO4/c16-11-4-2-6-13(8-11)20-9-14(15(18)19)10-3-1-5-12(17)7-10/h1-8,14,17H,9H2,(H,18,19) |
| InChIKey | GURUASRUSRIIDI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |