C16H21F3O4 — CID 11724424
3-hydroperoxy-4-pentan-3-yl-1-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isochromene (PubChem CID 11724424) has the molecular formula C16H21F3O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-hydroperoxy-4-pentan-3-yl-1-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isochromene.
| Compound Name | 3-hydroperoxy-4-pentan-3-yl-1-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 11724424 |
| Molecular Formula | C16H21F3O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-hydroperoxy-4-pentan-3-yl-1-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isochromene |
| SMILES | CCC(CC)C1c2ccccc2C(OCC(F)(F)F)OC1OO |
| InChI | InChI=1S/C16H21F3O4/c1-3-10(4-2)13-11-7-5-6-8-12(11)14(22-15(13)23-20)21-9-16(17,18)19/h5-8,10,13-15,20H,3-4,9H2,1-2H3 |
| InChIKey | DWVFVERPNYVTTI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|