About methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate
methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate (PubChem CID 11724485) has the molecular formula C14H13N3O7
and a molecular weight of 335.27 g/mol. Its IUPAC name is methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate |
| PubChem CID | 11724485 |
| Molecular Formula | C14H13N3O7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CC1C(=O)N(C)C(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H13N3O7/c1-16-12(19)8-4-3-7(17(22)23)5-9(8)10(13(16)20)6-11(18)15-14(21)24-2/h3-5,10H,6H2,1-2H3,(H,15,18,21) |
| InChIKey | HTELXKJIQZNNOT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate?
The IUPAC name of methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate (CID 11724485) is methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate.
What is the SMILES notation for methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate?
The canonical SMILES for methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate is COC(=O)NC(=O)CC1C(=O)N(C)C(=O)c2ccc([N+](=O)[O-])cc21.
What is the InChIKey of methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate?
The InChIKey is HTELXKJIQZNNOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O7/c1-16-12(19)8-4-3-7(17(22)23)5-9(8)10(13(16)20)6-11(18)15-14(21)24-2/h3-5,10H,6H2,1-2H3,(H,15,18,21).
What are the key properties of methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate?
methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate has a molecular weight of 335.27 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2-methyl-6-nitro-1,3-dioxo-4H-isoquinolin-4-yl)acetyl]carbamate is sourced from PubChem (CID 11724485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).