C13H18O2 — CID 117245576
1-cyclobutyl-2-(3-methylphenoxy)ethanol (PubChem CID 117245576) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-cyclobutyl-2-(3-methylphenoxy)ethanol.
| Compound Name | 1-cyclobutyl-2-(3-methylphenoxy)ethanol |
|---|---|
| PubChem CID | 117245576 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-cyclobutyl-2-(3-methylphenoxy)ethanol |
| SMILES | Cc1cccc(OCC(O)C2CCC2)c1 |
| InChI | InChI=1S/C13H18O2/c1-10-4-2-7-12(8-10)15-9-13(14)11-5-3-6-11/h2,4,7-8,11,13-14H,3,5-6,9H2,1H3 |
| InChIKey | WBWCJNOPQHMOKZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |