C20H36N2O2 — CID 11724594
8-methyl-8-[4-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)butyl]-8-azoniabicyclo[3.2.1]octan-3-olate (PubChem CID 11724594) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is 8-methyl-8-[4-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)butyl]-8-azoniabicyclo[3.2.1]octan-3-olate.
| Compound Name | 8-methyl-8-[4-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)butyl]-8-azoniabicyclo[3.2.1]octan-3-olate |
|---|---|
| PubChem CID | 11724594 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 8-methyl-8-[4-(8-methyl-3-oxido-8-azoniabicyclo[3.2.1]octan-8-yl)butyl]-8-azoniabicyclo[3.2.1]octan-3-olate |
| SMILES | C[N+]1(CCCC[N+]2(C)C3CCC2CC([O-])C3)C2CCC1CC([O-])C2 |
| InChI | InChI=1S/C20H36N2O2/c1-21(15-5-6-16(21)12-19(23)11-15)9-3-4-10-22(2)17-7-8-18(22)14-20(24)13-17/h15-20H,3-14H2,1-2H3 |
| InChIKey | KQTSANUSRCSLPA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|