C19H32O3Si — CID 11724596
(6aS,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-1,2,6,7,8,9,9a,9b-octahydrocyclopenta[f]chromen-3-one (PubChem CID 11724596) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (6aS,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-1,2,6,7,8,9,9a,9b-octahydrocyclopenta[f]chromen-3-one.
| Compound Name | (6aS,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-1,2,6,7,8,9,9a,9b-octahydrocyclopenta[f]chromen-3-one |
|---|---|
| PubChem CID | 11724596 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (6aS,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6a-methyl-1,2,6,7,8,9,9a,9b-octahydrocyclopenta[f]chromen-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC(=O)OC3=CC[C@]12C |
| InChI | InChI=1S/C19H32O3Si/c1-18(2,3)23(5,6)22-16-9-8-14-13-7-10-17(20)21-15(13)11-12-19(14,16)4/h11,13-14,16H,7-10,12H2,1-6H3/t13-,14-,16-,19-/m0/s1 |
| InChIKey | BXTTVVUCELGBCJ-PWDMQXDWSA-N |
| XLogP | 5.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|