About 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol
2-ethylpyrazolo[1,5-a]pyrimidin-6-ol (PubChem CID 117246784) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol.
Molecular Properties
| Compound Name | 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol |
| PubChem CID | 117246784 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol |
| SMILES | CCc1cc2ncc(O)cn2n1 |
| InChI | InChI=1S/C8H9N3O/c1-2-6-3-8-9-4-7(12)5-11(8)10-6/h3-5,12H,2H2,1H3 |
| InChIKey | WGAUQFFSEMQXPV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol?
The IUPAC name of 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol (CID 117246784) is 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol.
What is the SMILES notation for 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol?
The canonical SMILES for 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol is CCc1cc2ncc(O)cn2n1.
What is the InChIKey of 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol?
The InChIKey is WGAUQFFSEMQXPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-2-6-3-8-9-4-7(12)5-11(8)10-6/h3-5,12H,2H2,1H3.
What are the key properties of 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol?
2-ethylpyrazolo[1,5-a]pyrimidin-6-ol has a molecular weight of 163.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpyrazolo[1,5-a]pyrimidin-6-ol is sourced from PubChem (CID 117246784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).