C10H11FN2O2 — CID 117246884
4-amino-9-fluoro-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one (PubChem CID 117246884) has the molecular formula C10H11FN2O2 and a molecular weight of 210.21 g/mol. Its IUPAC name is 4-amino-9-fluoro-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one.
| Compound Name | 4-amino-9-fluoro-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one |
|---|---|
| PubChem CID | 117246884 |
| Molecular Formula | C10H11FN2O2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-amino-9-fluoro-2,3,4,6-tetrahydro-1,6-benzoxazocin-5-one |
| SMILES | NC1CCOc2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C10H11FN2O2/c11-6-1-2-8-9(5-6)15-4-3-7(12)10(14)13-8/h1-2,5,7H,3-4,12H2,(H,13,14) |
| InChIKey | BXRZYGLUMNGXHA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |