C17H24O5S — CID 11724822
[(1R,2R,4S)-3,3-dimethoxy-2-methyl-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate (PubChem CID 11724822) has the molecular formula C17H24O5S and a molecular weight of 340.44 g/mol. Its IUPAC name is [(1R,2R,4S)-3,3-dimethoxy-2-methyl-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,4S)-3,3-dimethoxy-2-methyl-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11724822 |
| Molecular Formula | C17H24O5S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(1R,2R,4S)-3,3-dimethoxy-2-methyl-2-bicyclo[2.2.1]heptanyl] 4-methylbenzenesulfonate |
| SMILES | COC1(OC)[C@H]2CC[C@H](C2)[C@@]1(C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H24O5S/c1-12-5-9-15(10-6-12)23(18,19)22-16(2)13-7-8-14(11-13)17(16,20-3)21-4/h5-6,9-10,13-14H,7-8,11H2,1-4H3/t13-,14+,16-/m1/s1 |
| InChIKey | YDFNGCDSKBQUFK-IJEWVQPXSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|