C23H34O2 — CID 11724959
2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol (PubChem CID 11724959) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol.
| Compound Name | 2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 11724959 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[(10Z,13E,15E)-heptadeca-10,13,15-trienyl]benzene-1,4-diol |
| SMILES | C/C=C/C=C/C/C=C\CCCCCCCCCc1cc(O)ccc1O |
| InChI | InChI=1S/C23H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-20-22(24)18-19-23(21)25/h2-5,7-8,18-20,24-25H,6,9-17H2,1H3/b3-2+,5-4+,8-7- |
| InChIKey | OILIDQCJCUQAGV-YCLNNTPMSA-N |
| XLogP | 6.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|