C22H37N3 — CID 11725008
(4S)-1-N,1-N-diethyl-4-N-(1,2,3,4,5,6,7,8-octahydroacridin-9-yl)pentane-1,4-diamine (PubChem CID 11725008) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is (4S)-1-N,1-N-diethyl-4-N-(1,2,3,4,5,6,7,8-octahydroacridin-9-yl)pentane-1,4-diamine.
| Compound Name | (4S)-1-N,1-N-diethyl-4-N-(1,2,3,4,5,6,7,8-octahydroacridin-9-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 11725008 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | (4S)-1-N,1-N-diethyl-4-N-(1,2,3,4,5,6,7,8-octahydroacridin-9-yl)pentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](C)Nc1c2c(nc3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C22H37N3/c1-4-25(5-2)16-10-11-17(3)23-22-18-12-6-8-14-20(18)24-21-15-9-7-13-19(21)22/h17H,4-16H2,1-3H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | YKORLKMHNGQVSH-KRWDZBQOSA-N |
| XLogP | 4.76 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |