C23H39N2+ — CID 11725009
(7S,8aS)-5-[[(4S,8S,9aS)-6,8-dimethyl-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium-4-yl]methyl]-1,7-dimethyl-3,4,6,7,8,8a-hexahydro-2H-quinoline (PubChem CID 11725009) has the molecular formula C23H39N2+ and a molecular weight of 343.58 g/mol. Its IUPAC name is (7S,8aS)-5-[[(4S,8S,9aS)-6,8-dimethyl-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium-4-yl]methyl]-1,7-dimethyl-3,4,6,7,8,8a-hexahydro-2H-quinoline.
| Compound Name | (7S,8aS)-5-[[(4S,8S,9aS)-6,8-dimethyl-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium-4-yl]methyl]-1,7-dimethyl-3,4,6,7,8,8a-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 11725009 |
| Molecular Formula | C23H39N2+ |
| Molecular Weight | 343.58 g/mol |
| Exact Mass | 343.31 |
| IUPAC Name | (7S,8aS)-5-[[(4S,8S,9aS)-6,8-dimethyl-1,2,3,4,7,8,9,9a-octahydroquinolizin-5-ium-4-yl]methyl]-1,7-dimethyl-3,4,6,7,8,8a-hexahydro-2H-quinoline |
| SMILES | CC1=[N+]2[C@H](CC3=C4CCCN(C)[C@H]4C[C@@H](C)C3)CCC[C@H]2C[C@H](C)C1 |
| InChI | InChI=1S/C23H39N2/c1-16-11-18(3)25-20(13-16)7-5-8-21(25)15-19-12-17(2)14-23-22(19)9-6-10-24(23)4/h16-17,20-21,23H,5-15H2,1-4H3/q+1/t16-,17+,20+,21+,23+/m1/s1 |
| InChIKey | OQDUBIXUEUDROW-DIEZWCIUSA-N |
| XLogP | 5.02 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|