About 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide
4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide (PubChem CID 117250416) has the molecular formula C12H13ClN2O2S
and a molecular weight of 284.77 g/mol. Its IUPAC name is 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide |
| PubChem CID | 117250416 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(c2nc(Cl)c3ccccn23)CC1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-11-10-3-1-2-6-15(10)12(14-11)9-4-7-18(16,17)8-5-9/h1-3,6,9H,4-5,7-8H2 |
| InChIKey | RKYCQWKDUSIASR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide?
The IUPAC name of 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide (CID 117250416) is 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide.
What is the SMILES notation for 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide?
The canonical SMILES for 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide is O=S1(=O)CCC(c2nc(Cl)c3ccccn23)CC1.
What is the InChIKey of 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide?
The InChIKey is RKYCQWKDUSIASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S/c13-11-10-3-1-2-6-15(10)12(14-11)9-4-7-18(16,17)8-5-9/h1-3,6,9H,4-5,7-8H2.
What are the key properties of 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide?
4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide has a molecular weight of 284.77 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloroimidazo[1,5-a]pyridin-3-yl)thiane 1,1-dioxide is sourced from PubChem (CID 117250416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).