About 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol
1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol (PubChem CID 117251530) has the molecular formula C12H8ClN3O
and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol.
Molecular Properties
| Compound Name | 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol |
| PubChem CID | 117251530 |
| Molecular Formula | C12H8ClN3O |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol |
| SMILES | Oc1ccc2c(Cl)nc(-c3ccncc3)n2c1 |
| InChI | InChI=1S/C12H8ClN3O/c13-11-10-2-1-9(17)7-16(10)12(15-11)8-3-5-14-6-4-8/h1-7,17H |
| InChIKey | BSCDMWPNZPUELZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol?
The IUPAC name of 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol (CID 117251530) is 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol.
What is the SMILES notation for 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol?
The canonical SMILES for 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol is Oc1ccc2c(Cl)nc(-c3ccncc3)n2c1.
What is the InChIKey of 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol?
The InChIKey is BSCDMWPNZPUELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3O/c13-11-10-2-1-9(17)7-16(10)12(15-11)8-3-5-14-6-4-8/h1-7,17H.
What are the key properties of 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol?
1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol has a molecular weight of 245.67 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-pyridin-4-ylimidazo[1,5-a]pyridin-6-ol is sourced from PubChem (CID 117251530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).