C19H18N6O — CID 11725170
5,7,15,18,20,25-hexazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,12(24),19,21-nonaen-14-one (PubChem CID 11725170) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 5,7,15,18,20,25-hexazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,12(24),19,21-nonaen-14-one.
| Compound Name | 5,7,15,18,20,25-hexazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,12(24),19,21-nonaen-14-one |
|---|---|
| PubChem CID | 11725170 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 5,7,15,18,20,25-hexazatetracyclo[17.3.1.12,6.18,12]pentacosa-1(23),2(25),3,5,8,10,12(24),19,21-nonaen-14-one |
| SMILES | O=C1Cc2cccc(c2)Nc2nccc(n2)-c2ccnc(c2)NCCN1 |
| InChI | InChI=1S/C19H18N6O/c26-18-11-13-2-1-3-15(10-13)24-19-23-7-5-16(25-19)14-4-6-20-17(12-14)21-8-9-22-18/h1-7,10,12H,8-9,11H2,(H,20,21)(H,22,26)(H,23,24,25) |
| InChIKey | KZGYPVVUXWLRLC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |