About 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol
1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol (PubChem CID 117252012) has the molecular formula C13H8Cl2N2O
and a molecular weight of 279.13 g/mol. Its IUPAC name is 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol.
Molecular Properties
| Compound Name | 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol |
| PubChem CID | 117252012 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol |
| SMILES | Oc1ccn2c(-c3ccc(Cl)cc3)nc(Cl)c2c1 |
| InChI | InChI=1S/C13H8Cl2N2O/c14-9-3-1-8(2-4-9)13-16-12(15)11-7-10(18)5-6-17(11)13/h1-7,18H |
| InChIKey | PIAHJTZEODPZQS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol?
The IUPAC name of 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol (CID 117252012) is 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol.
What is the SMILES notation for 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol?
The canonical SMILES for 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol is Oc1ccn2c(-c3ccc(Cl)cc3)nc(Cl)c2c1.
What is the InChIKey of 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol?
The InChIKey is PIAHJTZEODPZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N2O/c14-9-3-1-8(2-4-9)13-16-12(15)11-7-10(18)5-6-17(11)13/h1-7,18H.
What are the key properties of 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol?
1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol has a molecular weight of 279.13 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(4-chlorophenyl)imidazo[1,5-a]pyridin-7-ol is sourced from PubChem (CID 117252012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).