C12H9BrN2OS — CID 117252089
1-bromo-3-(thiophen-2-ylmethyl)imidazo[1,5-a]pyridin-7-ol (PubChem CID 117252089) has the molecular formula C12H9BrN2OS and a molecular weight of 309.19 g/mol. Its IUPAC name is 1-bromo-3-(thiophen-2-ylmethyl)imidazo[1,5-a]pyridin-7-ol.
| Compound Name | 1-bromo-3-(thiophen-2-ylmethyl)imidazo[1,5-a]pyridin-7-ol |
|---|---|
| PubChem CID | 117252089 |
| Molecular Formula | C12H9BrN2OS |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 1-bromo-3-(thiophen-2-ylmethyl)imidazo[1,5-a]pyridin-7-ol |
| SMILES | Oc1ccn2c(Cc3cccs3)nc(Br)c2c1 |
| InChI | InChI=1S/C12H9BrN2OS/c13-12-10-6-8(16)3-4-15(10)11(14-12)7-9-2-1-5-17-9/h1-6,16H,7H2 |
| InChIKey | MKCFDZVUGJDZDT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |