C16H30O6Si — CID 11725278
[(3aR,4R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-deuterio-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate (PubChem CID 11725278) has the molecular formula C16H30O6Si and a molecular weight of 347.50 g/mol. Its IUPAC name is [(3aR,4R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-deuterio-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate.
| Compound Name | [(3aR,4R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-deuterio-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate |
|---|---|
| PubChem CID | 11725278 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | [(3aR,4R,6aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-deuterio-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl] acetate |
| SMILES | [2H][C@]1(CO[Si](C)(C)C(C)(C)C)OC(OC(C)=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H30O6Si/c1-10(17)19-14-13-12(21-16(5,6)22-13)11(20-14)9-18-23(7,8)15(2,3)4/h11-14H,9H2,1-8H3/t11-,12-,13-,14?/m1/s1/i11D |
| InChIKey | MFUROHCCMWEUBA-FFTQANNISA-N |
| XLogP | 2.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|