C13H14ClN3O2 — CID 117252845
5-chloro-3-piperidin-4-ylimidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 117252845) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 5-chloro-3-piperidin-4-ylimidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 5-chloro-3-piperidin-4-ylimidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 117252845 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-chloro-3-piperidin-4-ylimidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | O=C(O)c1nc(C2CCNCC2)n2c(Cl)cccc12 |
| InChI | InChI=1S/C13H14ClN3O2/c14-10-3-1-2-9-11(13(18)19)16-12(17(9)10)8-4-6-15-7-5-8/h1-3,8,15H,4-7H2,(H,18,19) |
| InChIKey | HHAYLDZRDFOODZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|