C10H13N3O — CID 117253082
3-[1-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-ol (PubChem CID 117253082) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-[1-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-ol.
| Compound Name | 3-[1-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-ol |
|---|---|
| PubChem CID | 117253082 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-[1-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-ol |
| SMILES | CNC(C)c1ncc2cccc(O)n12 |
| InChI | InChI=1S/C10H13N3O/c1-7(11-2)10-12-6-8-4-3-5-9(14)13(8)10/h3-7,11,14H,1-2H3 |
| InChIKey | MIKNEUOUYFLRMZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |