C10H14N4 — CID 117253202
3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine (PubChem CID 117253202) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine.
| Compound Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117253202 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine |
| SMILES | CNCCc1ncc2cccc(N)n12 |
| InChI | InChI=1S/C10H14N4/c1-12-6-5-10-13-7-8-3-2-4-9(11)14(8)10/h2-4,7,12H,5-6,11H2,1H3 |
| InChIKey | ZUKCBRNRNGWXAV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |