About 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine
3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine (PubChem CID 117253202) has the molecular formula C10H14N4
and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine.
Molecular Properties
| Compound Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine |
| PubChem CID | 117253202 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine |
| SMILES | CNCCc1ncc2cccc(N)n12 |
| InChI | InChI=1S/C10H14N4/c1-12-6-5-10-13-7-8-3-2-4-9(11)14(8)10/h2-4,7,12H,5-6,11H2,1H3 |
| InChIKey | ZUKCBRNRNGWXAV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine?
The IUPAC name of 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine (CID 117253202) is 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine.
What is the SMILES notation for 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine?
The canonical SMILES for 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine is CNCCc1ncc2cccc(N)n12.
What is the InChIKey of 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine?
The InChIKey is ZUKCBRNRNGWXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4/c1-12-6-5-10-13-7-8-3-2-4-9(11)14(8)10/h2-4,7,12H,5-6,11H2,1H3.
What are the key properties of 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine?
3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine has a molecular weight of 190.25 g/mol, XLogP of 0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-5-amine is sourced from PubChem (CID 117253202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).