About 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine
1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine (PubChem CID 117253792) has the molecular formula C11H14BrN3
and a molecular weight of 268.16 g/mol. Its IUPAC name is 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine |
| PubChem CID | 117253792 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1ncc2ccc(Br)cn12 |
| InChI | InChI=1S/C11H14BrN3/c1-8(13-2)5-11-14-6-10-4-3-9(12)7-15(10)11/h3-4,6-8,13H,5H2,1-2H3 |
| InChIKey | VQJXVZNRSUCHIF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine?
The IUPAC name of 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine (CID 117253792) is 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine.
What is the SMILES notation for 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine?
The canonical SMILES for 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine is CNC(C)Cc1ncc2ccc(Br)cn12.
What is the InChIKey of 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine?
The InChIKey is VQJXVZNRSUCHIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrN3/c1-8(13-2)5-11-14-6-10-4-3-9(12)7-15(10)11/h3-4,6-8,13H,5H2,1-2H3.
What are the key properties of 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine?
1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine has a molecular weight of 268.16 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromoimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-2-amine is sourced from PubChem (CID 117253792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).