2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid

C9H6BrClN2O2 — CID 117254492

IUPAC2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1nc(Cl)c2cc(Br)ccn12
InChIInChI=1S/C9H6BrClN2O2/c10-5-1-2-13-6(3-5)9(11)12-7(13)4-8(14)15/h1-3H,4H2,(H,14,15)
InChIKeyMIQKTVCRLRKRRC-UHFFFAOYSA-N
MW289.52 g/mol
LogP2.38
Rot. Bonds2

About 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid

2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid (PubChem CID 117254492) has the molecular formula C9H6BrClN2O2 and a molecular weight of 289.52 g/mol. Its IUPAC name is 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid
PubChem CID117254492
Molecular FormulaC9H6BrClN2O2
Molecular Weight289.52 g/mol
Exact Mass287.93
IUPAC Name2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1nc(Cl)c2cc(Br)ccn12
InChIInChI=1S/C9H6BrClN2O2/c10-5-1-2-13-6(3-5)9(11)12-7(13)4-8(14)15/h1-3H,4H2,(H,14,15)
InChIKeyMIQKTVCRLRKRRC-UHFFFAOYSA-N
XLogP2.38
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.52
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid (CID 117254492) is 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid is O=C(O)Cc1nc(Cl)c2cc(Br)ccn12.
What is the InChIKey of 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid?
The InChIKey is MIQKTVCRLRKRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClN2O2/c10-5-1-2-13-6(3-5)9(11)12-7(13)4-8(14)15/h1-3H,4H2,(H,14,15).
What are the key properties of 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid?
2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid has a molecular weight of 289.52 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-1-chloroimidazo[1,5-a]pyridin-3-yl)acetic acid is sourced from PubChem (CID 117254492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).