About 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol
3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol (PubChem CID 117255001) has the molecular formula C10H12BrN3O
and a molecular weight of 270.13 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol |
| PubChem CID | 117255001 |
| Molecular Formula | C10H12BrN3O |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol |
| SMILES | NCCCc1nc(Br)c2c(O)cccn12 |
| InChI | InChI=1S/C10H12BrN3O/c11-10-9-7(15)3-2-6-14(9)8(13-10)4-1-5-12/h2-3,6,15H,1,4-5,12H2 |
| InChIKey | DRAWTEJACYENFK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol?
The IUPAC name of 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol (CID 117255001) is 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol.
What is the SMILES notation for 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol?
The canonical SMILES for 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol is NCCCc1nc(Br)c2c(O)cccn12.
What is the InChIKey of 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol?
The InChIKey is DRAWTEJACYENFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN3O/c11-10-9-7(15)3-2-6-14(9)8(13-10)4-1-5-12/h2-3,6,15H,1,4-5,12H2.
What are the key properties of 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol?
3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol has a molecular weight of 270.13 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropyl)-1-bromoimidazo[1,5-a]pyridin-8-ol is sourced from PubChem (CID 117255001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).