C12H14ClN3O2 — CID 117255040
8-chloro-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 117255040) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 8-chloro-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 8-chloro-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 117255040 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 8-chloro-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | CNCCCc1nc(C(=O)O)c2c(Cl)cccn12 |
| InChI | InChI=1S/C12H14ClN3O2/c1-14-6-2-5-9-15-10(12(17)18)11-8(13)4-3-7-16(9)11/h3-4,7,14H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | HIWLQUAPQHVCBX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|